C11H13ClO4 — CID 171863615
methyl 3-(3-chloro-4-methylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171863615) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is methyl 3-(3-chloro-4-methylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3-chloro-4-methylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171863615 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl 3-(3-chloro-4-methylphenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClO4/c1-6-3-4-7(5-8(6)12)9(13)10(14)11(15)16-2/h3-5,9-10,13-14H,1-2H3 |
| InChIKey | HUDKJKGKYSIKFD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |