C13H16O5 — CID 171864392
methyl 3-(4-acetyl-3-methylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171864392) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 3-(4-acetyl-3-methylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(4-acetyl-3-methylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864392 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl 3-(4-acetyl-3-methylphenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(C(C)=O)c(C)c1 |
| InChI | InChI=1S/C13H16O5/c1-7-6-9(4-5-10(7)8(2)14)11(15)12(16)13(17)18-3/h4-6,11-12,15-16H,1-3H3 |
| InChIKey | FDSCTSHCVLJMIC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |