C11H10FNO4 — CID 171864069
methyl 3-(3-cyano-4-fluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 171864069) has the molecular formula C11H10FNO4 and a molecular weight of 239.20 g/mol. Its IUPAC name is methyl 3-(3-cyano-4-fluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3-cyano-4-fluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864069 |
| Molecular Formula | C11H10FNO4 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | methyl 3-(3-cyano-4-fluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C11H10FNO4/c1-17-11(16)10(15)9(14)6-2-3-8(12)7(4-6)5-13/h2-4,9-10,14-15H,1H3 |
| InChIKey | FJSIUUAQSXSEON-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |