C10H8FNO4 — CID 170823998
3-(4-cyano-3-fluorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823998) has the molecular formula C10H8FNO4 and a molecular weight of 225.18 g/mol. Its IUPAC name is 3-(4-cyano-3-fluorophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(4-cyano-3-fluorophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823998 |
| Molecular Formula | C10H8FNO4 |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 3-(4-cyano-3-fluorophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | N#Cc1ccc(C(O)C(O)C(=O)O)cc1F |
| InChI | InChI=1S/C10H8FNO4/c11-7-3-5(1-2-6(7)4-12)8(13)9(14)10(15)16/h1-3,8-9,13-14H,(H,15,16) |
| InChIKey | DGAHERDANDDJKN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |