About 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid
3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid (PubChem CID 170824371) has the molecular formula C11H10FNO4
and a molecular weight of 239.20 g/mol. Its IUPAC name is 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid.
Analyze 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid (CID 170824371) is 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid is N#CCc1ccc(C(O)C(O)C(=O)O)cc1F.
What is the InChIKey of 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid?
The InChIKey is SYGQQJYIXBHAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO4/c12-8-5-7(2-1-6(8)3-4-13)9(14)10(15)11(16)17/h1-2,5,9-10,14-15H,3H2,(H,16,17).
What are the key properties of 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid?
3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid has a molecular weight of 239.20 g/mol, XLogP of 0.37, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(cyanomethyl)-3-fluorophenyl]-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170824371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).