C12H15FO4S — CID 171874634
2-[4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorophenyl]acetic acid (PubChem CID 171874634) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-[4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 171874634 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(O)C(O)CCS)cc1F |
| InChI | InChI=1S/C12H15FO4S/c13-9-5-8(12(17)10(14)3-4-18)2-1-7(9)6-11(15)16/h1-2,5,10,12,14,17-18H,3-4,6H2,(H,15,16) |
| InChIKey | FDJFKZZFQDLTSC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|