C11H15FN2O3 — CID 171899204
4-[4-(aminomethyl)-3-fluorophenyl]-3,4-dihydroxybutanamide (PubChem CID 171899204) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-3-fluorophenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[4-(aminomethyl)-3-fluorophenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899204 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-[4-(aminomethyl)-3-fluorophenyl]-3,4-dihydroxybutanamide |
| SMILES | NCc1ccc(C(O)C(O)CC(N)=O)cc1F |
| InChI | InChI=1S/C11H15FN2O3/c12-8-3-6(1-2-7(8)5-13)11(17)9(15)4-10(14)16/h1-3,9,11,15,17H,4-5,13H2,(H2,14,16) |
| InChIKey | FMCRHLAEDPOXLR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |