C14H15NO4 — CID 171899918
3,4-dihydroxy-4-(6-hydroxynaphthalen-2-yl)butanamide (PubChem CID 171899918) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(6-hydroxynaphthalen-2-yl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(6-hydroxynaphthalen-2-yl)butanamide |
|---|---|
| PubChem CID | 171899918 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3,4-dihydroxy-4-(6-hydroxynaphthalen-2-yl)butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C14H15NO4/c15-13(18)7-12(17)14(19)10-2-1-9-6-11(16)4-3-8(9)5-10/h1-6,12,14,16-17,19H,7H2,(H2,15,18) |
| InChIKey | BANJOIKNEMXBBN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |