C13H14O3S — CID 170820620
1-(6-hydroxynaphthalen-2-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820620) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-(6-hydroxynaphthalen-2-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(6-hydroxynaphthalen-2-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820620 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-(6-hydroxynaphthalen-2-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | Oc1ccc2cc(C(O)C(O)CS)ccc2c1 |
| InChI | InChI=1S/C13H14O3S/c14-11-4-3-8-5-10(2-1-9(8)6-11)13(16)12(15)7-17/h1-6,12-17H,7H2 |
| InChIKey | LNVVQNGJUIWCFD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|