C15H20ClNO2 — CID 171261493
6-[(1R,2S)-1-amino-2-hydroxypentyl]naphthalen-2-ol;hydrochloride (PubChem CID 171261493) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 6-[(1R,2S)-1-amino-2-hydroxypentyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 6-[(1R,2S)-1-amino-2-hydroxypentyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171261493 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-[(1R,2S)-1-amino-2-hydroxypentyl]naphthalen-2-ol;hydrochloride |
| SMILES | CCC[C@H](O)[C@H](N)c1ccc2cc(O)ccc2c1.Cl |
| InChI | InChI=1S/C15H19NO2.ClH/c1-2-3-14(18)15(16)12-5-4-11-9-13(17)7-6-10(11)8-12;/h4-9,14-15,17-18H,2-3,16H2,1H3;1H/t14-,15+;/m0./s1 |
| InChIKey | NVABLBPKSRHZAA-LDXVYITESA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |