C11H18ClNO3 — CID 171266831
5-[(1S,2R)-1-amino-2-hydroxypentyl]benzene-1,3-diol;hydrochloride (PubChem CID 171266831) has the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. Its IUPAC name is 5-[(1S,2R)-1-amino-2-hydroxypentyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 5-[(1S,2R)-1-amino-2-hydroxypentyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171266831 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-[(1S,2R)-1-amino-2-hydroxypentyl]benzene-1,3-diol;hydrochloride |
| SMILES | CCC[C@@H](O)[C@@H](N)c1cc(O)cc(O)c1.Cl |
| InChI | InChI=1S/C11H17NO3.ClH/c1-2-3-10(15)11(12)7-4-8(13)6-9(14)5-7;/h4-6,10-11,13-15H,2-3,12H2,1H3;1H/t10-,11+;/m1./s1 |
| InChIKey | PQOIQCSHUZJBDX-DHXVBOOMSA-N |
| XLogP | 1.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |