C11H16Cl3NO — CID 171160232
(1R,2S)-1-amino-1-(3,5-dichlorophenyl)pentan-2-ol;hydrochloride (PubChem CID 171160232) has the molecular formula C11H16Cl3NO and a molecular weight of 284.61 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3,5-dichlorophenyl)pentan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(3,5-dichlorophenyl)pentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171160232 |
| Molecular Formula | C11H16Cl3NO |
| Molecular Weight | 284.61 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | (1R,2S)-1-amino-1-(3,5-dichlorophenyl)pentan-2-ol;hydrochloride |
| SMILES | CCC[C@H](O)[C@H](N)c1cc(Cl)cc(Cl)c1.Cl |
| InChI | InChI=1S/C11H15Cl2NO.ClH/c1-2-3-10(15)11(14)7-4-8(12)6-9(13)5-7;/h4-6,10-11,15H,2-3,14H2,1H3;1H/t10-,11+;/m0./s1 |
| InChIKey | SPEXFMJYUJBBOT-VZXYPILPSA-N |
| XLogP | 3.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |