C13H22ClNO3 — CID 171160851
(1R,2S)-1-amino-1-(3,5-dimethoxyphenyl)pentan-2-ol;hydrochloride (PubChem CID 171160851) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3,5-dimethoxyphenyl)pentan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(3,5-dimethoxyphenyl)pentan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171160851 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(3,5-dimethoxyphenyl)pentan-2-ol;hydrochloride |
| SMILES | CCC[C@H](O)[C@H](N)c1cc(OC)cc(OC)c1.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-4-5-12(15)13(14)9-6-10(16-2)8-11(7-9)17-3;/h6-8,12-13,15H,4-5,14H2,1-3H3;1H/t12-,13+;/m0./s1 |
| InChIKey | PQJOYPQNEYQFSZ-JHEYCYPBSA-N |
| XLogP | 2.29 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |