C19H33NO2 — CID 171162047
4-[(1S,2R)-1-amino-2-hydroxypentyl]-2,6-ditert-butylphenol (PubChem CID 171162047) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-hydroxypentyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(1S,2R)-1-amino-2-hydroxypentyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 171162047 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-hydroxypentyl]-2,6-ditert-butylphenol |
| SMILES | CCC[C@@H](O)[C@@H](N)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO2/c1-8-9-15(21)16(20)12-10-13(18(2,3)4)17(22)14(11-12)19(5,6)7/h10-11,15-16,21-22H,8-9,20H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | FFIWDHPVHRPAFQ-CVEARBPZSA-N |
| XLogP | 4.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |