C60H90O4 — CID 22725890
2,6-ditert-butyl-4-[1,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)butyl]phenol (PubChem CID 22725890) has the molecular formula C60H90O4 and a molecular weight of 875.38 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)butyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)butyl]phenol |
|---|---|
| PubChem CID | 22725890 |
| Molecular Formula | C60H90O4 |
| Molecular Weight | 875.38 g/mol |
| Exact Mass | 874.68 |
| IUPAC Name | 2,6-ditert-butyl-4-[1,4,4-tris(3,5-ditert-butyl-4-hydroxyphenyl)butyl]phenol |
| SMILES | CC(C)(C)c1cc(C(CCC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C60H90O4/c1-53(2,3)41-27-35(28-42(49(41)61)54(4,5)6)39(36-29-43(55(7,8)9)50(62)44(30-36)56(10,11)12)25-26-40(37-31-45(57(13,14)15)51(63)46(32-37)58(16,17)18)38-33-47(59(19,20)21)52(64)48(34-38)60(22,23)24/h27-34,39-40,61-64H,25-26H2,1-24H3 |
| InChIKey | WOBNFQSZXXYQSI-UHFFFAOYSA-N |
| XLogP | 16.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.38 |
| LogP ≤ 5 | 16.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |