C17H29NO4 — CID 170872551
3-amino-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;hydrate (PubChem CID 170872551) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 3-amino-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;hydrate.
| Compound Name | 3-amino-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;hydrate |
|---|---|
| PubChem CID | 170872551 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 3-amino-3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;hydrate |
| SMILES | CC(C)(C)c1cc(C(N)CC(=O)O)cc(C(C)(C)C)c1O.O |
| InChI | InChI=1S/C17H27NO3.H2O/c1-16(2,3)11-7-10(13(18)9-14(19)20)8-12(15(11)21)17(4,5)6;/h7-8,13,21H,9,18H2,1-6H3,(H,19,20);1H2 |
| InChIKey | RPONXZVTYCDRAU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |