C62H90O8 — CID 87082508
2-[2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]oxyethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetate (PubChem CID 87082508) has the molecular formula C62H90O8 and a molecular weight of 963.39 g/mol. Its IUPAC name is 2-[2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]oxyethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetate.
| Compound Name | 2-[2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]oxyethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 87082508 |
| Molecular Formula | C62H90O8 |
| Molecular Weight | 963.39 g/mol |
| Exact Mass | 962.66 |
| IUPAC Name | 2-[2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetyl]oxyethyl 2,2-bis(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)c1cc(C(C(=O)OCCOC(=O)C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C62H90O8/c1-55(2,3)39-27-35(28-40(49(39)63)56(4,5)6)47(36-29-41(57(7,8)9)50(64)42(30-36)58(10,11)12)53(67)69-25-26-70-54(68)48(37-31-43(59(13,14)15)51(65)44(32-37)60(16,17)18)38-33-45(61(19,20)21)52(66)46(34-38)62(22,23)24/h27-34,47-48,63-66H,25-26H2,1-24H3 |
| InChIKey | FSJLOCOHKBKLBY-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.39 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|