C24H40O3 — CID 87087566
heptyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 87087566) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is heptyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | heptyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87087566 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | heptyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCCCCCCOC(=O)C(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H40O3/c1-9-10-11-12-13-14-27-22(26)17(2)18-15-19(23(3,4)5)21(25)20(16-18)24(6,7)8/h15-17,25H,9-14H2,1-8H3 |
| InChIKey | ILHWPYYJTFGKOJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|