C38H60O6 — CID 175569279
3,5-ditert-butyl-4-hydroxybenzoic acid;octyl 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 175569279) has the molecular formula C38H60O6 and a molecular weight of 612.89 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxybenzoic acid;octyl 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | 3,5-ditert-butyl-4-hydroxybenzoic acid;octyl 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 175569279 |
| Molecular Formula | C38H60O6 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxybenzoic acid;octyl 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)O)cc(C(C)(C)C)c1O.CCCCCCCCOC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H38O3.C15H22O3/c1-8-9-10-11-12-13-14-26-21(25)17-15-18(22(2,3)4)20(24)19(16-17)23(5,6)7;1-14(2,3)10-7-9(13(17)18)8-11(12(10)16)15(4,5)6/h15-16,24H,8-14H2,1-7H3;7-8,16H,1-6H3,(H,17,18) |
| InChIKey | WPOUUWBZCIGPNM-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|