C19H30O3 — CID 54423476
3-tert-butyl-4-hydroxy-5-(2-methylheptan-2-yl)benzoic acid (PubChem CID 54423476) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-tert-butyl-4-hydroxy-5-(2-methylheptan-2-yl)benzoic acid.
| Compound Name | 3-tert-butyl-4-hydroxy-5-(2-methylheptan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 54423476 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3-tert-butyl-4-hydroxy-5-(2-methylheptan-2-yl)benzoic acid |
| SMILES | CCCCCC(C)(C)c1cc(C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H30O3/c1-7-8-9-10-19(5,6)15-12-13(17(21)22)11-14(16(15)20)18(2,3)4/h11-12,20H,7-10H2,1-6H3,(H,21,22) |
| InChIKey | WCLCOERSADYDNQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|