C21H23I3O4 — CID 58245259
4-[4-hydroxy-3-iodo-5-(2-methylheptan-2-yl)phenoxy]-3,5-diiodobenzoic acid (PubChem CID 58245259) has the molecular formula C21H23I3O4 and a molecular weight of 720.12 g/mol. Its IUPAC name is 4-[4-hydroxy-3-iodo-5-(2-methylheptan-2-yl)phenoxy]-3,5-diiodobenzoic acid.
| Compound Name | 4-[4-hydroxy-3-iodo-5-(2-methylheptan-2-yl)phenoxy]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 58245259 |
| Molecular Formula | C21H23I3O4 |
| Molecular Weight | 720.12 g/mol |
| Exact Mass | 719.87 |
| IUPAC Name | 4-[4-hydroxy-3-iodo-5-(2-methylheptan-2-yl)phenoxy]-3,5-diiodobenzoic acid |
| SMILES | CCCCCC(C)(C)c1cc(Oc2c(I)cc(C(=O)O)cc2I)cc(I)c1O |
| InChI | InChI=1S/C21H23I3O4/c1-4-5-6-7-21(2,3)14-10-13(11-15(22)18(14)25)28-19-16(23)8-12(20(26)27)9-17(19)24/h8-11,25H,4-7H2,1-3H3,(H,26,27) |
| InChIKey | ZCWOZTAHJRXXII-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.12 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|