C15H22O4 — CID 54329774
2,5-dihydroxy-4-(2-methylheptan-2-yl)benzoic acid (PubChem CID 54329774) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,5-dihydroxy-4-(2-methylheptan-2-yl)benzoic acid.
| Compound Name | 2,5-dihydroxy-4-(2-methylheptan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 54329774 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2,5-dihydroxy-4-(2-methylheptan-2-yl)benzoic acid |
| SMILES | CCCCCC(C)(C)c1cc(O)c(C(=O)O)cc1O |
| InChI | InChI=1S/C15H22O4/c1-4-5-6-7-15(2,3)11-9-12(16)10(14(18)19)8-13(11)17/h8-9,16-17H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | SXMUHBOYLMXOJC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|