C18H28O3 — CID 142003707
6-(4-tert-butyl-2,5-dihydroxyphenyl)-6-methylheptan-2-one (PubChem CID 142003707) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-(4-tert-butyl-2,5-dihydroxyphenyl)-6-methylheptan-2-one.
| Compound Name | 6-(4-tert-butyl-2,5-dihydroxyphenyl)-6-methylheptan-2-one |
|---|---|
| PubChem CID | 142003707 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 6-(4-tert-butyl-2,5-dihydroxyphenyl)-6-methylheptan-2-one |
| SMILES | CC(=O)CCCC(C)(C)c1cc(O)c(C(C)(C)C)cc1O |
| InChI | InChI=1S/C18H28O3/c1-12(19)8-7-9-18(5,6)14-11-15(20)13(10-16(14)21)17(2,3)4/h10-11,20-21H,7-9H2,1-6H3 |
| InChIKey | CGFIRGZBYXKYTD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|