C14H19ClO3 — CID 19864950
methyl 5-(5-chloro-2-hydroxyphenyl)-5-methylhexanoate (PubChem CID 19864950) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is methyl 5-(5-chloro-2-hydroxyphenyl)-5-methylhexanoate.
| Compound Name | methyl 5-(5-chloro-2-hydroxyphenyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 19864950 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | methyl 5-(5-chloro-2-hydroxyphenyl)-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H19ClO3/c1-14(2,8-4-5-13(17)18-3)11-9-10(15)6-7-12(11)16/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | BFTLPUSMGZPLIQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |