C22H34O6 — CID 87411500
methyl 5-[3,6-dihydroxy-2-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate (PubChem CID 87411500) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is methyl 5-[3,6-dihydroxy-2-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate.
| Compound Name | methyl 5-[3,6-dihydroxy-2-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 87411500 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | methyl 5-[3,6-dihydroxy-2-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1c(O)ccc(O)c1C(C)(C)CCCC(=O)OC |
| InChI | InChI=1S/C22H34O6/c1-21(2,13-7-9-17(25)27-5)19-15(23)11-12-16(24)20(19)22(3,4)14-8-10-18(26)28-6/h11-12,23-24H,7-10,13-14H2,1-6H3 |
| InChIKey | YXXDTWWOBWAWMT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|