C14H21O6P — CID 19865009
[2-hydroxy-5-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]phosphonic acid (PubChem CID 19865009) has the molecular formula C14H21O6P and a molecular weight of 316.29 g/mol. Its IUPAC name is [2-hydroxy-5-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]phosphonic acid.
| Compound Name | [2-hydroxy-5-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 19865009 |
| Molecular Formula | C14H21O6P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [2-hydroxy-5-(6-methoxy-2-methyl-6-oxohexan-2-yl)phenyl]phosphonic acid |
| SMILES | COC(=O)CCCC(C)(C)c1ccc(O)c(P(=O)(O)O)c1 |
| InChI | InChI=1S/C14H21O6P/c1-14(2,8-4-5-13(16)20-3)10-6-7-11(15)12(9-10)21(17,18)19/h6-7,9,15H,4-5,8H2,1-3H3,(H2,17,18,19) |
| InChIKey | QMKPUTPWHFDEJT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|