C22H36O3 — CID 19865079
methyl 5-(3,5-ditert-butyl-2-hydroxyphenyl)-5-methylhexanoate (PubChem CID 19865079) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is methyl 5-(3,5-ditert-butyl-2-hydroxyphenyl)-5-methylhexanoate.
| Compound Name | methyl 5-(3,5-ditert-butyl-2-hydroxyphenyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 19865079 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | methyl 5-(3,5-ditert-butyl-2-hydroxyphenyl)-5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H36O3/c1-20(2,3)15-13-16(21(4,5)6)19(24)17(14-15)22(7,8)12-10-11-18(23)25-9/h13-14,24H,10-12H2,1-9H3 |
| InChIKey | YCPMXPCDJXBMFP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |