C22H38O — CID 20549645
2,6-ditert-butyl-4-(2-methylheptan-2-yl)phenol (PubChem CID 20549645) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2-methylheptan-2-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2-methylheptan-2-yl)phenol |
|---|---|
| PubChem CID | 20549645 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 2,6-ditert-butyl-4-(2-methylheptan-2-yl)phenol |
| SMILES | CCCCCC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H38O/c1-10-11-12-13-22(8,9)16-14-17(20(2,3)4)19(23)18(15-16)21(5,6)7/h14-15,23H,10-13H2,1-9H3 |
| InChIKey | WYUANIUCNJJLIY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|