C19H32O2 — CID 88687276
2-tert-butyl-4-(6-hydroxy-2-methylheptan-2-yl)-6-methylphenol (PubChem CID 88687276) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-tert-butyl-4-(6-hydroxy-2-methylheptan-2-yl)-6-methylphenol.
| Compound Name | 2-tert-butyl-4-(6-hydroxy-2-methylheptan-2-yl)-6-methylphenol |
|---|---|
| PubChem CID | 88687276 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-tert-butyl-4-(6-hydroxy-2-methylheptan-2-yl)-6-methylphenol |
| SMILES | Cc1cc(C(C)(C)CCCC(C)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H32O2/c1-13-11-15(12-16(17(13)21)18(3,4)5)19(6,7)10-8-9-14(2)20/h11-12,14,20-21H,8-10H2,1-7H3 |
| InChIKey | OVGSGRBKHZLIHE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |