C46H62O4 — CID 22725885
2-tert-butyl-6-methyl-4-[1,2,2-tris(3-tert-butyl-4-hydroxy-5-methylphenyl)ethyl]phenol (PubChem CID 22725885) has the molecular formula C46H62O4 and a molecular weight of 679.00 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-4-[1,2,2-tris(3-tert-butyl-4-hydroxy-5-methylphenyl)ethyl]phenol.
| Compound Name | 2-tert-butyl-6-methyl-4-[1,2,2-tris(3-tert-butyl-4-hydroxy-5-methylphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 22725885 |
| Molecular Formula | C46H62O4 |
| Molecular Weight | 679.00 g/mol |
| Exact Mass | 678.46 |
| IUPAC Name | 2-tert-butyl-6-methyl-4-[1,2,2-tris(3-tert-butyl-4-hydroxy-5-methylphenyl)ethyl]phenol |
| SMILES | Cc1cc(C(c2cc(C)c(O)c(C(C)(C)C)c2)C(c2cc(C)c(O)c(C(C)(C)C)c2)c2cc(C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C46H62O4/c1-25-17-29(21-33(39(25)47)43(5,6)7)37(30-18-26(2)40(48)34(22-30)44(8,9)10)38(31-19-27(3)41(49)35(23-31)45(11,12)13)32-20-28(4)42(50)36(24-32)46(14,15)16/h17-24,37-38,47-50H,1-16H3 |
| InChIKey | RHJNHPISWSNYOC-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.00 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |