C58H86O4 — CID 22725873
2,6-ditert-butyl-4-[1,2,2-tris(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol (PubChem CID 22725873) has the molecular formula C58H86O4 and a molecular weight of 847.32 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1,2,2-tris(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1,2,2-tris(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 22725873 |
| Molecular Formula | C58H86O4 |
| Molecular Weight | 847.32 g/mol |
| Exact Mass | 846.65 |
| IUPAC Name | 2,6-ditert-butyl-4-[1,2,2-tris(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(C)(C)c1cc(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C58H86O4/c1-51(2,3)37-25-33(26-38(47(37)59)52(4,5)6)45(34-27-39(53(7,8)9)48(60)40(28-34)54(10,11)12)46(35-29-41(55(13,14)15)49(61)42(30-35)56(16,17)18)36-31-43(57(19,20)21)50(62)44(32-36)58(22,23)24/h25-32,45-46,59-62H,1-24H3 |
| InChIKey | MJDPICJUNCYZHA-UHFFFAOYSA-N |
| XLogP | 15.85 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.32 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |