C17H29NO2 — CID 43209074
4-(2-amino-1-hydroxypropyl)-2,6-ditert-butylphenol (PubChem CID 43209074) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxypropyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(2-amino-1-hydroxypropyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 43209074 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 4-(2-amino-1-hydroxypropyl)-2,6-ditert-butylphenol |
| SMILES | CC(N)C(O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO2/c1-10(18)14(19)11-8-12(16(2,3)4)15(20)13(9-11)17(5,6)7/h8-10,14,19-20H,18H2,1-7H3 |
| InChIKey | DLKWPJGVIOMKSC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |