C17H30ClNO — CID 171197802
4-[(1R)-1-aminopropyl]-2,6-ditert-butylphenol;hydrochloride (PubChem CID 171197802) has the molecular formula C17H30ClNO and a molecular weight of 299.89 g/mol. Its IUPAC name is 4-[(1R)-1-aminopropyl]-2,6-ditert-butylphenol;hydrochloride.
| Compound Name | 4-[(1R)-1-aminopropyl]-2,6-ditert-butylphenol;hydrochloride |
|---|---|
| PubChem CID | 171197802 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-[(1R)-1-aminopropyl]-2,6-ditert-butylphenol;hydrochloride |
| SMILES | CC[C@@H](N)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C17H29NO.ClH/c1-8-14(18)11-9-12(16(2,3)4)15(19)13(10-11)17(5,6)7;/h9-10,14,19H,8,18H2,1-7H3;1H/t14-;/m1./s1 |
| InChIKey | WZJXPBHLNFDPNB-PFEQFJNWSA-N |
| XLogP | 4.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |