C19H33NO — CID 170161611
2,6-ditert-butyl-4-[1-(dimethylamino)propan-2-yl]phenol (PubChem CID 170161611) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1-(dimethylamino)propan-2-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1-(dimethylamino)propan-2-yl]phenol |
|---|---|
| PubChem CID | 170161611 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[1-(dimethylamino)propan-2-yl]phenol |
| SMILES | CC(CN(C)C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO/c1-13(12-20(8)9)14-10-15(18(2,3)4)17(21)16(11-14)19(5,6)7/h10-11,13,21H,12H2,1-9H3 |
| InChIKey | OBXGXEYBXYFTEF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |