C22H38O2 — CID 170163068
2,6-ditert-butyl-4-(1-hydroxy-6-methylheptan-2-yl)phenol (PubChem CID 170163068) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(1-hydroxy-6-methylheptan-2-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(1-hydroxy-6-methylheptan-2-yl)phenol |
|---|---|
| PubChem CID | 170163068 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 2,6-ditert-butyl-4-(1-hydroxy-6-methylheptan-2-yl)phenol |
| SMILES | CC(C)CCCC(CO)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H38O2/c1-15(2)10-9-11-16(14-23)17-12-18(21(3,4)5)20(24)19(13-17)22(6,7)8/h12-13,15-16,23-24H,9-11,14H2,1-8H3 |
| InChIKey | VXVCUXRXSWGJNF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |