C19H32OS — CID 174704090
2,6-ditert-butyl-4-(1-sulfanylpentyl)phenol (PubChem CID 174704090) has the molecular formula C19H32OS and a molecular weight of 308.53 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(1-sulfanylpentyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(1-sulfanylpentyl)phenol |
|---|---|
| PubChem CID | 174704090 |
| Molecular Formula | C19H32OS |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(1-sulfanylpentyl)phenol |
| SMILES | CCCCC(S)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H32OS/c1-8-9-10-16(21)13-11-14(18(2,3)4)17(20)15(12-13)19(5,6)7/h11-12,16,20-21H,8-10H2,1-7H3 |
| InChIKey | BCFVQBHNVWIBKZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|