C36H60O2 — CID 158079570
4-butyl-2,6-ditert-butylphenol (PubChem CID 158079570) has the molecular formula C36H60O2 and a molecular weight of 524.87 g/mol. Its IUPAC name is 4-butyl-2,6-ditert-butylphenol.
| Compound Name | 4-butyl-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 158079570 |
| Molecular Formula | C36H60O2 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 524.46 |
| IUPAC Name | 4-butyl-2,6-ditert-butylphenol |
| SMILES | CCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C18H30O/c2*1-8-9-10-13-11-14(17(2,3)4)16(19)15(12-13)18(5,6)7/h2*11-12,19H,8-10H2,1-7H3 |
| InChIKey | FMUBHIRRAXEWKV-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |