C34H56N2O4 — CID 118002642
2,6-ditert-butyl-4-[3-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]hydrazinyl]oxypropyl]phenol (PubChem CID 118002642) has the molecular formula C34H56N2O4 and a molecular weight of 556.83 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]hydrazinyl]oxypropyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]hydrazinyl]oxypropyl]phenol |
|---|---|
| PubChem CID | 118002642 |
| Molecular Formula | C34H56N2O4 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]hydrazinyl]oxypropyl]phenol |
| SMILES | CC(C)(C)c1cc(CCCONNOCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H56N2O4/c1-31(2,3)25-19-23(20-26(29(25)37)32(4,5)6)15-13-17-39-35-36-40-18-14-16-24-21-27(33(7,8)9)30(38)28(22-24)34(10,11)12/h19-22,35-38H,13-18H2,1-12H3 |
| InChIKey | ZCZYIARPBLBDSO-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|