C20H32O3S — CID 88815788
methyl 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetate (PubChem CID 88815788) has the molecular formula C20H32O3S and a molecular weight of 352.54 g/mol. Its IUPAC name is methyl 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetate.
| Compound Name | methyl 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetate |
|---|---|
| PubChem CID | 88815788 |
| Molecular Formula | C20H32O3S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O3S/c1-19(2,3)15-11-14(9-8-10-24-13-17(21)23-7)12-16(18(15)22)20(4,5)6/h11-12,22H,8-10,13H2,1-7H3 |
| InChIKey | ISDTVFBNRFZSRE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|