C24H34N2O2S — CID 4143225
2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-pyridin-4-ylacetamide (PubChem CID 4143225) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-pyridin-4-ylacetamide.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 4143225 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]-N-pyridin-4-ylacetamide |
| SMILES | CC(C)(C)c1cc(CCCSCC(=O)Nc2ccncc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H34N2O2S/c1-23(2,3)19-14-17(15-20(22(19)28)24(4,5)6)8-7-13-29-16-21(27)26-18-9-11-25-12-10-18/h9-12,14-15,28H,7-8,13,16H2,1-6H3,(H,25,26,27) |
| InChIKey | POMMCNUKCMEBDR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|