C26H35N3O5S — CID 5061519
N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetyl]-4-nitrobenzohydrazide (PubChem CID 5061519) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 5061519 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N'-[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propylsulfanyl]acetyl]-4-nitrobenzohydrazide |
| SMILES | CC(C)(C)c1cc(CCCSCC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H35N3O5S/c1-25(2,3)20-14-17(15-21(23(20)31)26(4,5)6)8-7-13-35-16-22(30)27-28-24(32)18-9-11-19(12-10-18)29(33)34/h9-12,14-15,31H,7-8,13,16H2,1-6H3,(H,27,30)(H,28,32) |
| InChIKey | HNDAVKOCRVKRKF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|