C19H20BrN3O5 — CID 3401535
3-bromo-4-tert-butyl-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide (PubChem CID 3401535) has the molecular formula C19H20BrN3O5 and a molecular weight of 450.29 g/mol. Its IUPAC name is 3-bromo-4-tert-butyl-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide.
| Compound Name | 3-bromo-4-tert-butyl-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3401535 |
| Molecular Formula | C19H20BrN3O5 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 3-bromo-4-tert-butyl-N'-[2-(4-nitrophenoxy)acetyl]benzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C19H20BrN3O5/c1-19(2,3)15-9-4-12(10-16(15)20)18(25)22-21-17(24)11-28-14-7-5-13(6-8-14)23(26)27/h4-10H,11H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | BTGVHNNDTTVZSO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|