C20H21BrN4O6S — CID 4956217
3-bromo-4-butoxy-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 4956217) has the molecular formula C20H21BrN4O6S and a molecular weight of 525.38 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4956217 |
| Molecular Formula | C20H21BrN4O6S |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 3-bromo-4-butoxy-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C20H21BrN4O6S/c1-2-3-10-30-17-9-4-13(11-16(17)21)19(27)22-20(32)24-23-18(26)12-31-15-7-5-14(6-8-15)25(28)29/h4-9,11H,2-3,10,12H2,1H3,(H,23,26)(H2,22,24,27,32) |
| InChIKey | DDDUEYVPRBENFL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|