C21H22BrN3O6S — CID 17074198
ethyl 4-[2-[2-[(3-bromo-4-ethoxybenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 17074198) has the molecular formula C21H22BrN3O6S and a molecular weight of 524.39 g/mol. Its IUPAC name is ethyl 4-[2-[2-[(3-bromo-4-ethoxybenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 4-[2-[2-[(3-bromo-4-ethoxybenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 17074198 |
| Molecular Formula | C21H22BrN3O6S |
| Molecular Weight | 524.39 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | ethyl 4-[2-[2-[(3-bromo-4-ethoxybenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)NNC(=S)NC(=O)c2ccc(OCC)c(Br)c2)cc1 |
| InChI | InChI=1S/C21H22BrN3O6S/c1-3-29-17-10-7-14(11-16(17)22)19(27)23-21(32)25-24-18(26)12-31-15-8-5-13(6-9-15)20(28)30-4-2/h5-11H,3-4,12H2,1-2H3,(H,24,26)(H2,23,25,27,32) |
| InChIKey | BHKGZMCYYJCAEJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|