C21H23BrClN3O4S — CID 17352455
3-bromo-N-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methylpropoxy)benzamide (PubChem CID 17352455) has the molecular formula C21H23BrClN3O4S and a molecular weight of 528.86 g/mol. Its IUPAC name is 3-bromo-N-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | 3-bromo-N-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17352455 |
| Molecular Formula | C21H23BrClN3O4S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 3-bromo-N-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methylpropoxy)benzamide |
| SMILES | Cc1cc(OCC(=O)NNC(=S)NC(=O)c2ccc(OCC(C)C)c(Br)c2)ccc1Cl |
| InChI | InChI=1S/C21H23BrClN3O4S/c1-12(2)10-30-18-7-4-14(9-16(18)22)20(28)24-21(31)26-25-19(27)11-29-15-5-6-17(23)13(3)8-15/h4-9,12H,10-11H2,1-3H3,(H,25,27)(H2,24,26,28,31) |
| InChIKey | JJSBLSYCYWPDNV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|