C19H17Cl2N3O5S — CID 4932741
ethyl 4-[2-[2-[(2,4-dichlorobenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate (PubChem CID 4932741) has the molecular formula C19H17Cl2N3O5S and a molecular weight of 470.33 g/mol. Its IUPAC name is ethyl 4-[2-[2-[(2,4-dichlorobenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate.
| Compound Name | ethyl 4-[2-[2-[(2,4-dichlorobenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 4932741 |
| Molecular Formula | C19H17Cl2N3O5S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | ethyl 4-[2-[2-[(2,4-dichlorobenzoyl)carbamothioyl]hydrazinyl]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCC(=O)NNC(=S)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O5S/c1-2-28-18(27)11-3-6-13(7-4-11)29-10-16(25)23-24-19(30)22-17(26)14-8-5-12(20)9-15(14)21/h3-9H,2,10H2,1H3,(H,23,25)(H2,22,24,26,30) |
| InChIKey | GFBZGHOILIHBBV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|