C17H13Cl2N3O4S — CID 17178688
methyl 4-[[(2,4-dichlorobenzoyl)amino]carbamothioylcarbamoyl]benzoate (PubChem CID 17178688) has the molecular formula C17H13Cl2N3O4S and a molecular weight of 426.28 g/mol. Its IUPAC name is methyl 4-[[(2,4-dichlorobenzoyl)amino]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[(2,4-dichlorobenzoyl)amino]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178688 |
| Molecular Formula | C17H13Cl2N3O4S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | methyl 4-[[(2,4-dichlorobenzoyl)amino]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)NNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O4S/c1-26-16(25)10-4-2-9(3-5-10)14(23)20-17(27)22-21-15(24)12-7-6-11(18)8-13(12)19/h2-8H,1H3,(H,21,24)(H2,20,22,23,27) |
| InChIKey | AHWNTGJRJSLVAO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|