C16H12Cl3N3O2S — CID 4937082
2-(4-chlorophenyl)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]acetamide (PubChem CID 4937082) has the molecular formula C16H12Cl3N3O2S and a molecular weight of 416.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4937082 |
| Molecular Formula | C16H12Cl3N3O2S |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NC(=S)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3N3O2S/c17-10-3-1-9(2-4-10)7-14(23)20-16(25)22-21-15(24)12-6-5-11(18)8-13(12)19/h1-6,8H,7H2,(H,21,24)(H2,20,22,23,25) |
| InChIKey | HDXFTFGWJKJGAT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|