C17H15Cl2N3O2S — CID 3505238
2,4-dichloro-N-[(3-phenylpropanoylamino)carbamothioyl]benzamide (PubChem CID 3505238) has the molecular formula C17H15Cl2N3O2S and a molecular weight of 396.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3-phenylpropanoylamino)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(3-phenylpropanoylamino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3505238 |
| Molecular Formula | C17H15Cl2N3O2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2,4-dichloro-N-[(3-phenylpropanoylamino)carbamothioyl]benzamide |
| SMILES | O=C(CCc1ccccc1)NNC(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O2S/c18-12-7-8-13(14(19)10-12)16(24)20-17(25)22-21-15(23)9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2,(H,21,23)(H2,20,22,24,25) |
| InChIKey | DTCMDKXDPQHQGC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|