C15H10BrCl2N3O2S — CID 4636694
2-bromo-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]benzamide (PubChem CID 4636694) has the molecular formula C15H10BrCl2N3O2S and a molecular weight of 447.14 g/mol. Its IUPAC name is 2-bromo-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4636694 |
| Molecular Formula | C15H10BrCl2N3O2S |
| Molecular Weight | 447.14 g/mol |
| Exact Mass | 444.91 |
| IUPAC Name | 2-bromo-N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10BrCl2N3O2S/c16-11-4-2-1-3-9(11)13(22)19-15(24)21-20-14(23)10-6-5-8(17)7-12(10)18/h1-7H,(H,20,23)(H2,19,21,22,24) |
| InChIKey | JKKLPMNXTADFKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.14 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|